Products 1804875-27-1
CAS 1804875-27-1 appears in our catalog under these names: 2-Chloro-3-(trifluoromethyl)benzene-1,4-diamine, 98%, Sorafenib Impurity 57. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-chloro-3-(trifluoromethyl)benzene-1,4-diamine (CAS 1804875-27-1) is a chemical compound with the molecular formula C7H6ClF3N2 and a molecular weight of 210.58 g/mol. IUPAC name: 2-chloro-3-(trifluoromethyl)benzene-1,4-diamine. InChIKey: TZNXDWWHZYBYJO-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2 |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 2-chloro-3-(trifluoromethyl)benzene-1,4-diamine |
| InChIKey | TZNXDWWHZYBYJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(F)(F)F)Cl)N |
Computed by PubChem (NCBI)