CAS 91626-53-8 appears in our catalog under these names: [4-Chloro-3-(trifluoromethyl)phenyl]hydrazine, 95%, (4-Chloro-3-(trifluoromethyl)phenyl)hydrazine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 250mg, 5g.
[4-chloro-3-(trifluoromethyl)phenyl]hydrazine (CAS 91626-53-8) is a chemical compound with the molecular formula C7H6ClF3N2 and a molecular weight of 210.58 g/mol. IUPAC name: [4-chloro-3-(trifluoromethyl)phenyl]hydrazine. InChIKey: FAZMLWKEIQLIJM-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2 |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | [4-chloro-3-(trifluoromethyl)phenyl]hydrazine |
| InChIKey | FAZMLWKEIQLIJM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NN)C(F)(F)F)Cl |
Computed by PubChem (NCBI)