CAS 1187929-36-7 is the registry number for 2,4,5-Trifluoro-benzamidine hydrochloride, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100mg, 5g, 1g, 250mg, on request.
2,4,5-trifluorobenzenecarboximidamide;hydrochloride (CAS 1187929-36-7) is a chemical compound with the molecular formula C7H6ClF3N2 and a molecular weight of 210.58 g/mol. IUPAC name: 2,4,5-trifluorobenzenecarboximidamide;hydrochloride. InChIKey: IQLSDTAQNDYPDY-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2 |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 2,4,5-trifluorobenzenecarboximidamide;hydrochloride |
| InChIKey | IQLSDTAQNDYPDY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)F)C(=N)N.Cl |
Computed by PubChem (NCBI)