CAS 1060809-07-5 appears in our catalog under these names: 1-(4-Chloropyridin-2-yl)-2,2,2-trifluoroethanamine, 95%, 1-(4-Chloropyridin-2-yl)-2,2,2-trifluoroethanamine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine (CAS 1060809-07-5) is a chemical compound with the molecular formula C7H6ClF3N2 and a molecular weight of 210.58 g/mol. IUPAC name: 1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine. InChIKey: DHJAKRJDZPEGQU-UHFFFAOYSA-N.
| Molecular formula | C7H6ClF3N2 |
|---|---|
| Molecular weight | 210.58 g/mol |
| IUPAC name | 1-(4-chloro-2-pyridinyl)-2,2,2-trifluoroethanamine |
| InChIKey | DHJAKRJDZPEGQU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(C(F)(F)F)N |
Computed by PubChem (NCBI)