cas: 149524-47-0 — see every product listed under this CAS number, including other names
(3-FLUOROPHENYL)CARBAMIC ACID BENZYL ESTER, 98% (CAS 149524-47-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F531036-100MG |
| cas | 149524-47-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 706.02 Pln | |
| Fluorochem | 5g | 2002.44 Pln | |
| Fluorochem | 10g | 3215.55 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl N-(3-fluorophenyl)carbamate (CAS 149524-47-0) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: benzyl N-(3-fluorophenyl)carbamate. InChIKey: LHLKGCMCFFJNCS-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO2 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | benzyl N-(3-fluorophenyl)carbamate |
| InChIKey | LHLKGCMCFFJNCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)