CAS 1261948-82-6 is the registry number for 3-Amino-5-(3-fluoro-2-methylphenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-amino-5-(3-fluoro-2-methylphenyl)benzoic acid (CAS 1261948-82-6) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: 3-amino-5-(3-fluoro-2-methylphenyl)benzoic acid. InChIKey: CJNNLHJGPSVYML-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO2 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | 3-amino-5-(3-fluoro-2-methylphenyl)benzoic acid |
| InChIKey | CJNNLHJGPSVYML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1F)C2=CC(=CC(=C2)N)C(=O)O |
Computed by PubChem (NCBI)