Products 1261948-82-6

CAS 1261948-82-6 is the registry number for 3-Amino-5-(3-fluoro-2-methylphenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

3-amino-5-(3-fluoro-2-methylphenyl)benzoic acid (CAS 1261948-82-6) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: 3-amino-5-(3-fluoro-2-methylphenyl)benzoic acid. InChIKey: CJNNLHJGPSVYML-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12FNO2
Molecular weight245.25 g/mol
IUPAC name3-amino-5-(3-fluoro-2-methylphenyl)benzoic acid
InChIKeyCJNNLHJGPSVYML-UHFFFAOYSA-N
SMILESCC1=C(C=CC=C1F)C2=CC(=CC(=C2)N)C(=O)O

Computed by PubChem (NCBI)