CAS 1823241-87-7 is the registry number for 2-(Benzyloxy)-5-fluorobenzamide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
5-fluoro-2-phenylmethoxybenzamide (CAS 1823241-87-7) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: 5-fluoro-2-phenylmethoxybenzamide. InChIKey: WEDXAODDXHVSJN-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO2 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | 5-fluoro-2-phenylmethoxybenzamide |
| InChIKey | WEDXAODDXHVSJN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)F)C(=O)N |
Computed by PubChem (NCBI)