CAS 727-74-2 appears in our catalog under these names: 7-Fluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid, 95%, 7-Fluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
7-fluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid (CAS 727-74-2) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: 7-fluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid. InChIKey: YIWXZCMEDNUVEH-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO2 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | 7-fluoro-1,2,3,4-tetrahydroacridine-9-carboxylic acid |
| InChIKey | YIWXZCMEDNUVEH-UHFFFAOYSA-N |
| SMILES | C1CCC2=NC3=C(C=C(C=C3)F)C(=C2C1)C(=O)O |
Computed by PubChem (NCBI)