CAS 149524-47-0 appears in our catalog under these names: (3-Fluorophenyl)carbamic acid benzyl ester, 95%, Carbamic acid,N-(3-fluorophenyl)-, phenylmethyl ester, 98%, 98%, (3-FLUOROPHENYL)CARBAMIC ACID BENZYL ESTER, 98%, Benzyl (3-fluorophenyl)carbamate, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 100mg, 250mg.
Benzyl N-(3-fluorophenyl)carbamate (CAS 149524-47-0) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: benzyl N-(3-fluorophenyl)carbamate. InChIKey: LHLKGCMCFFJNCS-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO2 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | benzyl N-(3-fluorophenyl)carbamate |
| InChIKey | LHLKGCMCFFJNCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)