cas: 1400755-06-7 — see every product listed under this CAS number, including other names
(3-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol, 98% (CAS 1400755-06-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696231-250MG |
| cas | 1400755-06-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 1997.23 Pln | |
| Fluorochem | 10g | 3298.86 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 1400755-06-7) is a chemical compound with the molecular formula C13H18BFO3 and a molecular weight of 252.09 g/mol. IUPAC name: [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: PFTKOQBWYWEFTD-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | [3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | PFTKOQBWYWEFTD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)CO |
Computed by PubChem (NCBI)