CAS 1190129-83-9 appears in our catalog under these names: 2-(2-Fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%, 2-(2-Fluoro-5-Methoxyphenyl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 25g.
2-(2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1190129-83-9) is a chemical compound with the molecular formula C13H18BFO3 and a molecular weight of 252.09 g/mol. IUPAC name: 2-(2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MHZNHBAXBGMBIH-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 2-(2-fluoro-5-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MHZNHBAXBGMBIH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC)F |
Computed by PubChem (NCBI)