CAS 1314141-37-1 appears in our catalog under these names: 2-Fluoro-4-(hydroxymethyl)phenylboronic acid pinacol ester, 96%, 2-Fluoro-4-(hydroxymethyl)phenylboronic acid pinacol ester, (3-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol, 96%. Offered by: Combi-blocks, TRC, Ambeed. Available pack sizes: 5g, 1g, 250mg, 50mg.
[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 1314141-37-1) is a chemical compound with the molecular formula C13H18BFO3 and a molecular weight of 252.09 g/mol. IUPAC name: [3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: JMJGAHCXMCINOI-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | [3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | JMJGAHCXMCINOI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)CO)F |
Computed by PubChem (NCBI)