CAS 2121512-07-8 is the registry number for 4-Fluoro-3-hydroxy-5-methylphenylboronic acid, pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2121512-07-8) is a chemical compound with the molecular formula C13H18BFO3 and a molecular weight of 252.09 g/mol. IUPAC name: 2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: ZJIDTVPQHXCQMT-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 2-fluoro-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | ZJIDTVPQHXCQMT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)O)F)C |
Computed by PubChem (NCBI)