CAS 1807622-74-7 appears in our catalog under these names: 2-Fluoro-6-hydroxy-4-methylphenylboronic acid pinacol ester, 95%, 2-Fluoro-6-hydroxy-4-methylphenylboronic acid pinacol ester, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg.
3-fluoro-5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 1807622-74-7) is a chemical compound with the molecular formula C13H18BFO3 and a molecular weight of 252.09 g/mol. IUPAC name: 3-fluoro-5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: WOXGJVSKOYPPIP-UHFFFAOYSA-N.
| Molecular formula | C13H18BFO3 |
|---|---|
| Molecular weight | 252.09 g/mol |
| IUPAC name | 3-fluoro-5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | WOXGJVSKOYPPIP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2F)C)O |
Computed by PubChem (NCBI)