CAS 1000805-94-6 appears in our catalog under these names: 1-(3-Fluorobenzyl)hydrazine dihydrochloride, (3-Fluorobenzyl)hydrazine dihydrochloride, 95%, 95%, 1-(3-Fluorobenzyl)hydrazine dihydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g, 100g.
(3-fluorophenyl)methylhydrazine;dihydrochloride (CAS 1000805-94-6) is a chemical compound with the molecular formula C7H11Cl2FN2 and a molecular weight of 213.08 g/mol. IUPAC name: (3-fluorophenyl)methylhydrazine;dihydrochloride. InChIKey: QQOXKVIRUHMNPF-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2FN2 |
|---|---|
| Molecular weight | 213.08 g/mol |
| IUPAC name | (3-fluorophenyl)methylhydrazine;dihydrochloride |
| InChIKey | QQOXKVIRUHMNPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CNN.Cl.Cl |
Computed by PubChem (NCBI)