CAS 606139-20-2 appears in our catalog under these names: 2-Amino-4-fluorobenzylamine dihydrochloride, Benzenemethanamine, 2-amino-4-fluoro-, dihydrochloride, 98%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 10g, 25g, 50g, 1g.
2-(aminomethyl)-5-fluoroaniline;dihydrochloride (CAS 606139-20-2) is a chemical compound with the molecular formula C7H11Cl2FN2 and a molecular weight of 213.08 g/mol. IUPAC name: 2-(aminomethyl)-5-fluoroaniline;dihydrochloride. InChIKey: LDQOYZYUGJUANQ-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2FN2 |
|---|---|
| Molecular weight | 213.08 g/mol |
| IUPAC name | 2-(aminomethyl)-5-fluoroaniline;dihydrochloride |
| InChIKey | LDQOYZYUGJUANQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)N)CN.Cl.Cl |
Computed by PubChem (NCBI)