CAS 1349715-77-0 appears in our catalog under these names: 2-Fluorobenzylhydrazine dihydrochloride, 96%, (2-Fluorobenzyl)hydrazine dihydrochloride, 97%, 97%, 1-(2-Fluorobenzyl)hydrazine dihydrochloride, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g, 1g, 250mg.
(2-fluorophenyl)methylhydrazine;dihydrochloride (CAS 1349715-77-0) is a chemical compound with the molecular formula C7H11Cl2FN2 and a molecular weight of 213.08 g/mol. IUPAC name: (2-fluorophenyl)methylhydrazine;dihydrochloride. InChIKey: JXGBATVWHGJBEX-UHFFFAOYSA-N.
| Molecular formula | C7H11Cl2FN2 |
|---|---|
| Molecular weight | 213.08 g/mol |
| IUPAC name | (2-fluorophenyl)methylhydrazine;dihydrochloride |
| InChIKey | JXGBATVWHGJBEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNN)F.Cl.Cl |
Computed by PubChem (NCBI)