CAS 1208893-73-5 appears in our catalog under these names: (1S)-1-(5-Fluoropyridin-2-yl)ethan-1-amine dihydrochloride, 95%, (S)–1–(5–Fluoropyridin–2–yl)ethanamine dihydrochloride, (S)-1-(5-Fluoropyridin-2-yl)ethanamine Dihydrochloride, (S)-1-(5-Fluoropyridin-2-yl)ethanamine dihydrochloride 97%, (1S)-1-(5-Fluoropyridin-2-yl)ethanamine dihydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg, 0,5g, 50mg.
(1S)-1-(5-fluoro-2-pyridinyl)ethanamine;dihydrochloride (CAS 1208893-73-5) is a chemical compound with the molecular formula C7H11Cl2FN2 and a molecular weight of 213.08 g/mol. IUPAC name: (1S)-1-(5-fluoro-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: HYHHMRDWSZCHPZ-XRIGFGBMSA-N.
| Molecular formula | C7H11Cl2FN2 |
|---|---|
| Molecular weight | 213.08 g/mol |
| IUPAC name | (1S)-1-(5-fluoro-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | HYHHMRDWSZCHPZ-XRIGFGBMSA-N |
| SMILES | C[C@@H](C1=NC=C(C=C1)F)N.Cl.Cl |
Computed by PubChem (NCBI)