CAS 2061996-65-2 appears in our catalog under these names: (R)–1–(6–Fluoropyridin–2–yl)ethanamine dihydrochloride, (1R)-1-(6-Fluoro(2-pyridyl))ethylamine dihydrochloride, 95%, (R)-1-(6-Fluoropyridin-2-yl)ethanamine dihydrochloride, 97%, (R)-1-(6-Fluoropyridin-2-yl)ethanamine dihydrochloride, 97%, 97%. Offered by: GLPBio, Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(6-fluoro-2-pyridinyl)ethanamine;dihydrochloride (CAS 2061996-65-2) is a chemical compound with the molecular formula C7H11Cl2FN2 and a molecular weight of 213.08 g/mol. IUPAC name: (1R)-1-(6-fluoro-2-pyridinyl)ethanamine;dihydrochloride. InChIKey: LAPSSXQERAHMRK-ZJIMSODOSA-N.
| Molecular formula | C7H11Cl2FN2 |
|---|---|
| Molecular weight | 213.08 g/mol |
| IUPAC name | (1R)-1-(6-fluoro-2-pyridinyl)ethanamine;dihydrochloride |
| InChIKey | LAPSSXQERAHMRK-ZJIMSODOSA-N |
| SMILES | C[C@H](C1=NC(=CC=C1)F)N.Cl.Cl |
Computed by PubChem (NCBI)