(3-Methoxy-5-methylphenyl)boronic acid, 98%
cas: 725251-81-0 — see every product listed under this CAS number, including other names
(3-Methoxy-5-methylphenyl)boronic acid, 98% (CAS 725251-81-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F219657-100MG |
| cas | 725251-81-0 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 5g | 1736.91 Pln | |
| Fluorochem | 25g | 5673.02 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1710.94 Pln | |
| Ambeed | 25g | 5549.06 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1854.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(3-methoxy-5-methylphenyl)boronic acid (CAS 725251-81-0) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (3-methoxy-5-methylphenyl)boronic acid. InChIKey: DJBDBFHWWWCNER-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (3-methoxy-5-methylphenyl)boronic acid |
| InChIKey | DJBDBFHWWWCNER-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC)C)(O)O |
Computed by PubChem (NCBI)