Products 725251-81-0
CAS 725251-81-0 is the registry number for (3-Methoxy-5-methylphenyl)boronic acid, 98%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
(3-methoxy-5-methylphenyl)boronic acid (CAS 725251-81-0) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (3-methoxy-5-methylphenyl)boronic acid. InChIKey: DJBDBFHWWWCNER-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (3-methoxy-5-methylphenyl)boronic acid |
| InChIKey | DJBDBFHWWWCNER-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OC)C)(O)O |
Computed by PubChem (NCBI)