(3-Nitrophenyl)methanesulfonyl chloride, 95%
cas: 58032-84-1 — see every product listed under this CAS number, including other names
(3-Nitrophenyl)methanesulfonyl chloride, 95% (CAS 58032-84-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A221215-250mg |
| cas | 58032-84-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 793.12 Pln | |
| Ambeed | 25g | 2929.12 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 269.93 Pln | |
| BLDpharm | 5g | 853.06 Pln | |
| BLDpharm | 25g | 3152.25 Pln | |
| Fluorochem | 250mg | 180.16 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 1148.57 Pln | |
| Fluorochem | 25g | 4418.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(3-nitrophenyl)methanesulfonyl chloride (CAS 58032-84-1) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: (3-nitrophenyl)methanesulfonyl chloride. InChIKey: IUYFKLDRPZLAQQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | (3-nitrophenyl)methanesulfonyl chloride |
| InChIKey | IUYFKLDRPZLAQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])CS(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
(3-nitrophenyl)methanesulfonyl chloride, benzenemethanesulfonyl chloride, 3-nitro-, IUYFKLDRPZLAQQ-UHFFFAOYSA-N, 3-Nitrobenzylsulfonyl Chloride, chloro[(3-nitrophenyl)methyl]sulfone, 3-nitro-a-toluenesulfonyl chlorid, 3-nitro-a-toluenesulfonyl chloride, 3-Nitro-^a-toluenesulfonyl chloride, (3-nitrophenyl)methanesulfonylchloride, 3-nitro-phenylmethane-sulfonyl chloride