CAS 53250-84-3 appears in our catalog under these names: 4-Sulphamoyl-2-chlorobenzoic acid, 2-Chloro-4-sulfamoylbenzoic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50mg, 0,5g.
2-chloro-4-sulfamoylbenzoic acid (CAS 53250-84-3) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 2-chloro-4-sulfamoylbenzoic acid. InChIKey: RUOXWQNWRLQUBE-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 2-chloro-4-sulfamoylbenzoic acid |
| InChIKey | RUOXWQNWRLQUBE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)Cl)C(=O)O |
Computed by PubChem (NCBI)