Products 24974-75-2

CAS 24974-75-2 appears in our catalog under these names: (2-Nitrophenyl)methanesulfonyl chloride, 95%, (2-Nitrophenyl)methanesulfonyl chloride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(2-nitrophenyl)methanesulfonyl chloride (CAS 24974-75-2) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: (2-nitrophenyl)methanesulfonyl chloride. InChIKey: FUEFNUGYRWQHTH-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6ClNO4S
Molecular weight235.65 g/mol
IUPAC name(2-nitrophenyl)methanesulfonyl chloride
InChIKeyFUEFNUGYRWQHTH-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)CS(=O)(=O)Cl)[N+](=O)[O-]

Computed by PubChem (NCBI)