CAS 24974-75-2 appears in our catalog under these names: (2-Nitrophenyl)methanesulfonyl chloride, 95%, (2-Nitrophenyl)methanesulfonyl chloride 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.
(2-nitrophenyl)methanesulfonyl chloride (CAS 24974-75-2) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: (2-nitrophenyl)methanesulfonyl chloride. InChIKey: FUEFNUGYRWQHTH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | (2-nitrophenyl)methanesulfonyl chloride |
| InChIKey | FUEFNUGYRWQHTH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CS(=O)(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)