CAS 1116097-04-1 appears in our catalog under these names: 5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97%, 97%, (S)-tert-Butyl (4-oxocyclopent-2-en-1-yl)carbamate, 97%, 97%, 2-Chloropropane-1,3-diol, 97%, 2-Chloro-1,3-propanediol 97%, 2-Chloro-5-sulfamoylbenzoic acid, 95%. Offered by: Chemat, AmBeed, Fluorochem, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 500mg, 25mg, 50mg, 5g, 10g.
2-chloro-5-sulfamoylbenzoic acid (CAS 97-04-1) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 2-chloro-5-sulfamoylbenzoic acid. InChIKey: LWDSANAOYPHQAW-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 2-chloro-5-sulfamoylbenzoic acid |
| InChIKey | LWDSANAOYPHQAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)C(=O)O)Cl |
Computed by PubChem (NCBI)