CAS 121-02-8 appears in our catalog under these names: 2–Methyl–5–nitrobenzenesulfonyl chloride, 2-Methyl-5-nitrobenzenesulfonyl chloride, 97% , 2-Methyl-5-nitrobenzenesulfonyl Chloride, >98.0%(GC)(T), 2-Methyl-5-nitrobenzene-1-sulfonyl chloride 96%, 2-METHYL-5-NITROBENZENESULFONYL CHLORID&. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 20g.
2-methyl-5-nitrobenzenesulfonyl chloride (CAS 121-02-8) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 2-methyl-5-nitrobenzenesulfonyl chloride. InChIKey: WPGVQDHXOUAJBW-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 2-methyl-5-nitrobenzenesulfonyl chloride |
| InChIKey | WPGVQDHXOUAJBW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)