cas: 109221-90-1 — see every product listed under this CAS number, including other names
(3-Phenoxy-phenyl)-hydrazine HCl, 97%, 97% (CAS 109221-90-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119R0O-100mg |
| cas | 109221-90-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 832.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-phenoxyphenyl)hydrazine;hydrochloride (CAS 109221-90-1) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: (3-phenoxyphenyl)hydrazine;hydrochloride. InChIKey: ASGHYEJXROPEMM-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | (3-phenoxyphenyl)hydrazine;hydrochloride |
| InChIKey | ASGHYEJXROPEMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)NN.Cl |
Computed by PubChem (NCBI)