CAS 1208-12-4 appears in our catalog under these names: Glycine beta-naphthylamide hydrochloride, 95%, H–Gly–βNA · HCl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
2-amino-N-naphthalen-2-ylacetamide;hydrochloride (CAS 1208-12-4) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: 2-amino-N-naphthalen-2-ylacetamide;hydrochloride. InChIKey: CDOBGWIHUYXBJY-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 2-amino-N-naphthalen-2-ylacetamide;hydrochloride |
| InChIKey | CDOBGWIHUYXBJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)NC(=O)CN.Cl |
Computed by PubChem (NCBI)