CAS 1445655-59-3 appears in our catalog under these names: 6-Chlorospiro[indoline-3,4'-piperidin]-2-one, 95%, 6-Chlorospiro(indoline-3,4'-piperidin)-2-one, 98%, 6–Chloro–1,2–dihydrospiro(indole–3,4'–piperidine)–2–one. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
6-chlorospiro[1H-indole-3,4'-piperidine]-2-one (CAS 1445655-59-3) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one. InChIKey: RLORPWSNHWBLLU-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 6-chlorospiro[1H-indole-3,4'-piperidine]-2-one |
| InChIKey | RLORPWSNHWBLLU-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=C(C=C3)Cl)NC2=O |
Computed by PubChem (NCBI)