Products 925563-30-0
CAS 925563-30-0 appears in our catalog under these names: 1-(4-Chlorophenyl)-3-isopropyl-1h-pyrazol-5-ol, 95%, 1-(4-Chlorophenyl)-3-isopropyl-1H-pyrazol-5-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(4-chlorophenyl)-5-propan-2-yl-1H-pyrazol-3-one (CAS 925563-30-0) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-propan-2-yl-1H-pyrazol-3-one. InChIKey: SIPIBWCUXXNPKY-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-propan-2-yl-1H-pyrazol-3-one |
| InChIKey | SIPIBWCUXXNPKY-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)N(N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)