cas: 109221-90-1 — see every product listed under this CAS number, including other names
(3-Phenoxyphenyl)hydrazine hydrochloride 97% (CAS 109221-90-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A918206-100mg |
| cas | 109221-90-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 303.62 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1065.69 Pln | |
| Ambeed | 5g | 3630.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A918206 |
(3-phenoxyphenyl)hydrazine;hydrochloride (CAS 109221-90-1) is a chemical compound with the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. IUPAC name: (3-phenoxyphenyl)hydrazine;hydrochloride. InChIKey: ASGHYEJXROPEMM-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O |
|---|---|
| Molecular weight | 236.70 g/mol |
| IUPAC name | (3-phenoxyphenyl)hydrazine;hydrochloride |
| InChIKey | ASGHYEJXROPEMM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)NN.Cl |
Computed by PubChem (NCBI)