cas: 54408-35-4 — see every product listed under this CAS number, including other names
(3-Phenylisoxazol-5-yl)methanamine 95% (CAS 54408-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A881040-100mg |
| cas | 54408-35-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 809.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A881040 |
(3-phenyl-1,2-oxazol-5-yl)methanamine (CAS 54408-35-4) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (3-phenyl-1,2-oxazol-5-yl)methanamine. InChIKey: AQZLTCXQTOKUAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (3-phenyl-1,2-oxazol-5-yl)methanamine |
| InChIKey | AQZLTCXQTOKUAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2)CN |
Computed by PubChem (NCBI)