cas: 54408-35-4 — see every product listed under this CAS number, including other names
(3-Phenylisoxazol-5-yl)methanamine, 95%, 95% (CAS 54408-35-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9BZ-50mg |
| cas | 54408-35-4 |
| size | 50mg |
| availability | 1.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 146.00 Pln | |
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 659.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3-phenyl-1,2-oxazol-5-yl)methanamine (CAS 54408-35-4) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (3-phenyl-1,2-oxazol-5-yl)methanamine. InChIKey: AQZLTCXQTOKUAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (3-phenyl-1,2-oxazol-5-yl)methanamine |
| InChIKey | AQZLTCXQTOKUAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2)CN |
Computed by PubChem (NCBI)