cas: 54408-35-4 — see every product listed under this CAS number, including other names
(3-Phenylisoxazol-5-yl)methylamine, 95% (CAS 54408-35-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | CC64513CB |
| cas | 54408-35-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 549.81 Pln | |
| Thermo Scientific | 1g | 1023.25 Pln | |
| Thermo Scientific | 5g | 3151.21 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
(3-phenyl-1,2-oxazol-5-yl)methanamine (CAS 54408-35-4) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: (3-phenyl-1,2-oxazol-5-yl)methanamine. InChIKey: AQZLTCXQTOKUAA-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | (3-phenyl-1,2-oxazol-5-yl)methanamine |
| InChIKey | AQZLTCXQTOKUAA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=C2)CN |
Computed by PubChem (NCBI)