cas: 1049730-10-0 — see every product listed under this CAS number, including other names
(3-cyclopropylphenyl)boronic acid, 98% (CAS 1049730-10-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F521363-100MG |
| cas | 1049730-10-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 221.81 Pln | |
| Fluorochem | 250mg | 346.77 Pln | |
| Fluorochem | 1g | 789.32 Pln | |
| Fluorochem | 5g | 2856.30 Pln | |
| Fluorochem | 10g | 4819.15 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-cyclopropylphenyl)boronic acid (CAS 1049730-10-0) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: (3-cyclopropylphenyl)boronic acid. InChIKey: BFFVQXUPALEVGS-UHFFFAOYSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | (3-cyclopropylphenyl)boronic acid |
| InChIKey | BFFVQXUPALEVGS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2CC2)(O)O |
Computed by PubChem (NCBI)