CAS 302333-80-8 appears in our catalog under these names: 4-Cyclopropylphenylboronic Acid, (4-Cyclopropylphenyl)boronic acid 97%, Boronic acid, B-(4-cyclopropylphenyl)-, 97%, 97%, (4-Cyclopropylphenyl)boronic acid, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 100mg, 250mg, 1g, 5g, 10g.
(4-cyclopropylphenyl)boronic acid (CAS 302333-80-8) is a chemical compound with the molecular formula C9H11BO2 and a molecular weight of 162.00 g/mol. IUPAC name: (4-cyclopropylphenyl)boronic acid. InChIKey: YNLGFXOBRXSMJZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO2 |
|---|---|
| Molecular weight | 162.00 g/mol |
| IUPAC name | (4-cyclopropylphenyl)boronic acid |
| InChIKey | YNLGFXOBRXSMJZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2CC2)(O)O |
Computed by PubChem (NCBI)