cas: 336182-14-0 — see every product listed under this CAS number, including other names
(3R,4R)-3-Amino-4-hydroxypentanoic acid hydrochloride, 95% (CAS 336182-14-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F080003-100MG |
| cas | 336182-14-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 601.89 Pln | |
| Fluorochem | 250mg | 971.55 Pln | |
| Fluorochem | 1g | 2481.44 Pln | |
| Fluorochem | 5g | 9026.01 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(3R,4R)-3-amino-4-hydroxypentanoic acid;hydrochloride (CAS 336182-14-0) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: (3R,4R)-3-amino-4-hydroxypentanoic acid;hydrochloride. InChIKey: XFOXVGBKIZQZCB-VKKIDBQXSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (3R,4R)-3-amino-4-hydroxypentanoic acid;hydrochloride |
| InChIKey | XFOXVGBKIZQZCB-VKKIDBQXSA-N |
| SMILES | C[C@H]([C@@H](CC(=O)O)N)O.Cl |
Computed by PubChem (NCBI)