Products 956902-65-1
CAS 956902-65-1 appears in our catalog under these names: (1S,2R,3S,4R)-4-Aminocyclopentane-1,2,3-triol hydrochloride, 95%, rac-(1R,2S,3R,4S)-4-Aminocyclopentane-1,2,3-triol hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 500mg, 100mg, 0,5g, 50mg.
(1S,2R,3S,4R)-4-aminocyclopentane-1,2,3-triol;hydrochloride (CAS 956902-65-1) is a chemical compound with the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. IUPAC name: (1S,2R,3S,4R)-4-aminocyclopentane-1,2,3-triol;hydrochloride. InChIKey: ASBCITMWTLYRBD-FLGKMABCSA-N.
| Molecular formula | C5H12ClNO3 |
|---|---|
| Molecular weight | 169.61 g/mol |
| IUPAC name | (1S,2R,3S,4R)-4-aminocyclopentane-1,2,3-triol;hydrochloride |
| InChIKey | ASBCITMWTLYRBD-FLGKMABCSA-N |
| SMILES | C1[C@H]([C@@H]([C@@H]([C@H]1O)O)O)N.Cl |
Computed by PubChem (NCBI)