cas: 39002-30-7 — see every product listed under this CAS number, including other names
(3S,4R,5R)-1-AMINO-3,4,5,6-TETRAHYDROXYHEXAN-2-ONE HYDROCHLORIDE, 98% (CAS 39002-30-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844694-25MG |
| cas | 39002-30-7 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 497.76 Pln | |
| Fluorochem | 50mg | 799.74 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride (CAS 39002-30-7) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride. InChIKey: BXEJEZFWNIJRIM-RWOHWRPJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride |
| InChIKey | BXEJEZFWNIJRIM-RWOHWRPJSA-N |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)CN)O)O)O)O.Cl |
Computed by PubChem (NCBI)