cas: 39002-30-7 — see every product listed under this CAS number, including other names
1-Amino-1-deoxy-D-fructose HCl, ≥95%, ≥95% (CAS 39002-30-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CN18-25mg |
| cas | 39002-30-7 |
| size | 25mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 424.40 Pln | |
| Chemat | 100mg | 851.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride (CAS 39002-30-7) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride. InChIKey: BXEJEZFWNIJRIM-RWOHWRPJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride |
| InChIKey | BXEJEZFWNIJRIM-RWOHWRPJSA-N |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)CN)O)O)O)O.Cl |
Computed by PubChem (NCBI)