cas: 39002-30-7 — see every product listed under this CAS number, including other names
1-Amino-1-deoxy-D-fructose (hydrochloride) (CAS 39002-30-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 50mg, 100mg, 500mg. Offered by: TargetMol.
| brand | TargetMol |
|---|---|
| catalog number | T35442-1g |
| cas | 39002-30-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1g | 10732.68 Pln | |
| TargetMol | 50mg | 1196.14 Pln | |
| TargetMol | 100mg | 2046.38 Pln | |
| TargetMol | 500mg | 6887.32 Pln |
| purity | No data |
|---|---|
| delivery time | on request |
(3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride (CAS 39002-30-7) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride. InChIKey: BXEJEZFWNIJRIM-RWOHWRPJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (3S,4R,5R)-1-amino-3,4,5,6-tetrahydroxyhexan-2-one;hydrochloride |
| InChIKey | BXEJEZFWNIJRIM-RWOHWRPJSA-N |
| SMILES | C([C@H]([C@H]([C@@H](C(=O)CN)O)O)O)O.Cl |
Computed by PubChem (NCBI)