CAS 87-79-6 appears in our catalog under these names: L-(-)-Sorbose, L-Sorbose, L-Sorbose, >95% (HPLC), (3S,4R,5S)-1,3,4,5,6-Pentahydroxyhexan-2-one/ 99.78% (existing batch purity), L–Sorbose. Offered by: Mikromol, Dr. Ehrenstorfer, TRC, TargetMol, GLPBio. Available pack sizes: 25mg, 250mg, 10g, 250g, 50g, 100mg, 500mg, 10mM (in 1ml water).
(3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one (CAS 87-79-6) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. IUPAC name: (3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one. InChIKey: BJHIKXHVCXFQLS-OTWZMJIISA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (3S,4R,5S)-1,3,4,5,6-pentahydroxyhexan-2-one |
| InChIKey | BJHIKXHVCXFQLS-OTWZMJIISA-N |
| SMILES | C([C@@H]([C@H]([C@@H](C(=O)CO)O)O)O)O |
Computed by PubChem (NCBI)