cas: 187032-53-7 — see every product listed under this CAS number, including other names
(3S,4S)-1-Benzyl-3,4-dihydroxypyrrolidine-2,5-dione, 95%, 95% (CAS 187032-53-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11APZ0-1g |
| cas | 187032-53-7 |
| size | 1g |
| availability | 115g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2459.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3S,4S)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione (CAS 187032-53-7) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: (3S,4S)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione. InChIKey: IZBMPGFJNIDMRR-IUCAKERBSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | (3S,4S)-1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione |
| InChIKey | IZBMPGFJNIDMRR-IUCAKERBSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)[C@H]([C@@H](C2=O)O)O |
Computed by PubChem (NCBI)