CAS 332040-86-5 appears in our catalog under these names: 1-Benzyl-3,4-dihydroxypyrrolidine-2,5-dione, 98%, 1-Benzyl-3,4-dihydroxypyrrolidine-2,5-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 0,5g, 50mg.
1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione (CAS 332040-86-5) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione. InChIKey: IZBMPGFJNIDMRR-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 1-benzyl-3,4-dihydroxypyrrolidine-2,5-dione |
| InChIKey | IZBMPGFJNIDMRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C(C(C2=O)O)O |
Computed by PubChem (NCBI)