cas: 1523530-09-7 — see every product listed under this CAS number, including other names
(3S,4S)-Benzyl 4-amino-3-fluoropiperidine-1-carboxylate, 97%, 97% (CAS 1523530-09-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXYO-100mg |
| cas | 1523530-09-7 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 909.20 Pln | |
| Chemat | 250mg | 1418.00 Pln | |
| Chemat | 500mg | 2320.40 Pln | |
| Chemat | 1g | 3443.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3S,4S)-4-amino-3-fluoropiperidine-1-carboxylate (CAS 1523530-09-7) is a chemical compound with the molecular formula C13H17FN2O2 and a molecular weight of 252.28 g/mol. IUPAC name: benzyl (3S,4S)-4-amino-3-fluoropiperidine-1-carboxylate. InChIKey: SYVUWEZGXXHYPH-RYUDHWBXSA-N.
| Molecular formula | C13H17FN2O2 |
|---|---|
| Molecular weight | 252.28 g/mol |
| IUPAC name | benzyl (3S,4S)-4-amino-3-fluoropiperidine-1-carboxylate |
| InChIKey | SYVUWEZGXXHYPH-RYUDHWBXSA-N |
| SMILES | C1CN(C[C@@H]([C@H]1N)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)