Products 938303-42-5

CAS 938303-42-5 is the registry number for 2-(4-(4-Fluorophenyl)piperazin-1-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[4-(4-fluorophenyl)piperazin-1-yl]propanoic acid (CAS 938303-42-5) is a chemical compound with the molecular formula C13H17FN2O2 and a molecular weight of 252.28 g/mol. IUPAC name: 2-[4-(4-fluorophenyl)piperazin-1-yl]propanoic acid. InChIKey: IRTYSUJMVHOJSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17FN2O2
Molecular weight252.28 g/mol
IUPAC name2-[4-(4-fluorophenyl)piperazin-1-yl]propanoic acid
InChIKeyIRTYSUJMVHOJSQ-UHFFFAOYSA-N
SMILESCC(C(=O)O)N1CCN(CC1)C2=CC=C(C=C2)F

Computed by PubChem (NCBI)