cas: 132488-71-2 — see every product listed under this CAS number, including other names
(3aR,4R,6R,7aS)-3a,5,5-Trimethyl-2-vinylhexahydro-4,6-methanobenzo(d)(1,3,2)dioxaborole, 98% mix TBC as stabilizer (CAS 132488-71-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A498337-5g |
| cas | 132488-71-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 3116.68 Pln | |
| AmBeed | 100mg | 421.54 Pln | |
| AmBeed | 10g | 5147.80 Pln |
| purity | 98% mix TBC as stabilizer |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R,2R,6S,8R)-4-ethenyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane (CAS 132488-71-2) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: (1R,2R,6S,8R)-4-ethenyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane. InChIKey: POAOFRAFKLHZGL-MWGHHZFTSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | (1R,2R,6S,8R)-4-ethenyl-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decane |
| InChIKey | POAOFRAFKLHZGL-MWGHHZFTSA-N |
| SMILES | B1(O[C@H]2C[C@H]3C[C@@H]([C@]2(O1)C)C3(C)C)C=C |
Computed by PubChem (NCBI)