CAS 263397-82-6 is the registry number for (3,5-Diisopropylphenyl)boronic acid, 95%. Offered by: Ambeed. Available pack sizes: 25g, 250mg, 10g, 1g, 5g.
[3,5-di(propan-2-yl)phenyl]boronic acid (CAS 263397-82-6) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: [3,5-di(propan-2-yl)phenyl]boronic acid. InChIKey: LHMPHKBDIKUKRC-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | [3,5-di(propan-2-yl)phenyl]boronic acid |
| InChIKey | LHMPHKBDIKUKRC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)