CAS 950778-38-8 appears in our catalog under these names: (4-(Tert-butyl)-2,6-dimethylphenyl)boronic acid, 98%, 98%, (4-(TERT-BUTYL)-2,6-DIMETHYLPHENYL)BORONIC ACID, 95%, (4-(tert-Butyl)-2,6-dimethylphenyl)boronic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-tert-butyl-2,6-dimethylphenyl)boronic acid (CAS 950778-38-8) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: (4-tert-butyl-2,6-dimethylphenyl)boronic acid. InChIKey: FIAQKPCRNZANJC-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | (4-tert-butyl-2,6-dimethylphenyl)boronic acid |
| InChIKey | FIAQKPCRNZANJC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)