Products 950778-38-8
CAS 950778-38-8 is the registry number for (4-(tert-Butyl)-2,6-dimethylphenyl)boronic acid, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
(4-tert-butyl-2,6-dimethylphenyl)boronic acid (CAS 950778-38-8) is a chemical compound with the molecular formula C12H19BO2 and a molecular weight of 206.09 g/mol. IUPAC name: (4-tert-butyl-2,6-dimethylphenyl)boronic acid. InChIKey: FIAQKPCRNZANJC-UHFFFAOYSA-N.
| Molecular formula | C12H19BO2 |
|---|---|
| Molecular weight | 206.09 g/mol |
| IUPAC name | (4-tert-butyl-2,6-dimethylphenyl)boronic acid |
| InChIKey | FIAQKPCRNZANJC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)