cas: 14440-56-3 — see every product listed under this CAS number, including other names
(3aS,6R,6aS)-6-((R)-2,2-Dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyldihydrofuro(3,4-d)(1,3)dioxol-4(3aH)-one, 95+% (CAS 14440-56-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A779315-10g |
| cas | 14440-56-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 18350.08 Pln | |
| AmBeed | 5g | 10140.97 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one (CAS 14440-56-3) is a chemical compound with the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. IUPAC name: (3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one. InChIKey: OFZPAXSEAVOAKB-HXFLIBJXSA-N.
| Molecular formula | C12H18O6 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (3aS,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one |
| InChIKey | OFZPAXSEAVOAKB-HXFLIBJXSA-N |
| SMILES | CC1(OC[C@@H](O1)[C@@H]2[C@H]3[C@@H](C(=O)O2)OC(O3)(C)C)C |
Computed by PubChem (NCBI)